About (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one
(3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one (PubChem CID 95284786) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one.
Molecular Properties
| Compound Name | (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one |
| PubChem CID | 95284786 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one |
| SMILES | Cc1ncc2c(n1)CN([C@H]1CCOC1=O)CC2 |
| InChI | InChI=1S/C12H15N3O2/c1-8-13-6-9-2-4-15(7-10(9)14-8)11-3-5-17-12(11)16/h6,11H,2-5,7H2,1H3/t11-/m0/s1 |
| InChIKey | NWXAMZSLKARSFL-NSHDSACASA-N |
| XLogP | 0.46 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one?
The IUPAC name of (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one (CID 95284786) is (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one.
What is the SMILES notation for (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one?
The canonical SMILES for (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one is Cc1ncc2c(n1)CN([C@H]1CCOC1=O)CC2.
What is the InChIKey of (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one?
The InChIKey is NWXAMZSLKARSFL-NSHDSACASA-N. The full InChI is InChI=1S/C12H15N3O2/c1-8-13-6-9-2-4-15(7-10(9)14-8)11-3-5-17-12(11)16/h6,11H,2-5,7H2,1H3/t11-/m0/s1.
What are the key properties of (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one?
(3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one has a molecular weight of 233.27 g/mol, XLogP of 0.46, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl)oxolan-2-one is sourced from PubChem (CID 95284786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).