C16H32N2O — CID 95284863
1-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-4-propylpiperazine (PubChem CID 95284863) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is 1-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-4-propylpiperazine.
| Compound Name | 1-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-4-propylpiperazine |
|---|---|
| PubChem CID | 95284863 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 1-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-4-propylpiperazine |
| SMILES | CCCN1CCN(CCO[C@H]2CCCC[C@@H]2C)CC1 |
| InChI | InChI=1S/C16H32N2O/c1-3-8-17-9-11-18(12-10-17)13-14-19-16-7-5-4-6-15(16)2/h15-16H,3-14H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | QNDQEEMTZVADMC-HOTGVXAUSA-N |
| XLogP | 2.61 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |