C18H20N4O2 — CID 95286190
5-ethyl-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]-1-pyridin-2-ylpyrazole-4-carboxamide (PubChem CID 95286190) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 5-ethyl-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]-1-pyridin-2-ylpyrazole-4-carboxamide.
| Compound Name | 5-ethyl-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]-1-pyridin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 95286190 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 5-ethyl-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]-1-pyridin-2-ylpyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)N[C@H](C)c2ccc(C)o2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C18H20N4O2/c1-4-15-14(11-20-22(15)17-7-5-6-10-19-17)18(23)21-13(3)16-9-8-12(2)24-16/h5-11,13H,4H2,1-3H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | LTYARHGDYLBZEQ-CYBMUJFWSA-N |
| XLogP | 3.22 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |