About 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine
4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine (PubChem CID 95286991) has the molecular formula C16H20N6S
and a molecular weight of 328.44 g/mol. Its IUPAC name is 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine |
| PubChem CID | 95286991 |
| Molecular Formula | C16H20N6S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine |
| SMILES | C[C@H]1CN(c2ncnc3ccsc23)CCN1Cc1nccn1C |
| InChI | InChI=1S/C16H20N6S/c1-12-9-22(16-15-13(3-8-23-15)18-11-19-16)7-6-21(12)10-14-17-4-5-20(14)2/h3-5,8,11-12H,6-7,9-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | KWVZGFZUGZECHX-LBPRGKRZSA-N |
| XLogP | 2.14 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine?
The IUPAC name of 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine (CID 95286991) is 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine.
What is the SMILES notation for 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine?
The canonical SMILES for 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine is C[C@H]1CN(c2ncnc3ccsc23)CCN1Cc1nccn1C.
What is the InChIKey of 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine?
The InChIKey is KWVZGFZUGZECHX-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H20N6S/c1-12-9-22(16-15-13(3-8-23-15)18-11-19-16)7-6-21(12)10-14-17-4-5-20(14)2/h3-5,8,11-12H,6-7,9-10H2,1-2H3/t12-/m0/s1.
What are the key properties of 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine?
4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine has a molecular weight of 328.44 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S)-3-methyl-4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]thieno[3,2-d]pyrimidine is sourced from PubChem (CID 95286991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).