About N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide
N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide (PubChem CID 95288528) has the molecular formula C19H26N4O
and a molecular weight of 326.44 g/mol. Its IUPAC name is N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide.
Molecular Properties
| Compound Name | N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide |
| PubChem CID | 95288528 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide |
| SMILES | Cc1cnn([C@H](C)[C@H](C)NCc2ccc(C(=O)NC3CC3)cc2)c1 |
| InChI | InChI=1S/C19H26N4O/c1-13-10-21-23(12-13)15(3)14(2)20-11-16-4-6-17(7-5-16)19(24)22-18-8-9-18/h4-7,10,12,14-15,18,20H,8-9,11H2,1-3H3,(H,22,24)/t14-,15+/m0/s1 |
| InChIKey | PFKVLWPDANADCR-LSDHHAIUSA-N |
| XLogP | 2.82 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide?
The IUPAC name of N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide (CID 95288528) is N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide.
What is the SMILES notation for N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide?
The canonical SMILES for N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide is Cc1cnn([C@H](C)[C@H](C)NCc2ccc(C(=O)NC3CC3)cc2)c1.
What is the InChIKey of N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide?
The InChIKey is PFKVLWPDANADCR-LSDHHAIUSA-N. The full InChI is InChI=1S/C19H26N4O/c1-13-10-21-23(12-13)15(3)14(2)20-11-16-4-6-17(7-5-16)19(24)22-18-8-9-18/h4-7,10,12,14-15,18,20H,8-9,11H2,1-3H3,(H,22,24)/t14-,15+/m0/s1.
What are the key properties of N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide?
N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide has a molecular weight of 326.44 g/mol, XLogP of 2.82, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-4-[[[(2S,3R)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]methyl]benzamide is sourced from PubChem (CID 95288528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).