C13H16BrN3OS — CID 95289806
(2R)-4-[(5-bromothiophen-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine (PubChem CID 95289806) has the molecular formula C13H16BrN3OS and a molecular weight of 342.26 g/mol. Its IUPAC name is (2R)-4-[(5-bromothiophen-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine.
| Compound Name | (2R)-4-[(5-bromothiophen-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine |
|---|---|
| PubChem CID | 95289806 |
| Molecular Formula | C13H16BrN3OS |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | (2R)-4-[(5-bromothiophen-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine |
| SMILES | Brc1cc(CN2CCO[C@@H](Cn3cccn3)C2)cs1 |
| InChI | InChI=1S/C13H16BrN3OS/c14-13-6-11(10-19-13)7-16-4-5-18-12(8-16)9-17-3-1-2-15-17/h1-3,6,10,12H,4-5,7-9H2/t12-/m1/s1 |
| InChIKey | QDEJBMMWZRWHIL-GFCCVEGCSA-N |
| XLogP | 2.61 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |