About [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate
[(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate (PubChem CID 95291315) has the molecular formula C19H26N2O4
and a molecular weight of 346.43 g/mol. Its IUPAC name is [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate.
Molecular Properties
| Compound Name | [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate |
| PubChem CID | 95291315 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate |
| SMILES | CCOCCCC(=O)O[C@H](c1ccc(OC)cc1)[C@@H](C)n1cccn1 |
| InChI | InChI=1S/C19H26N2O4/c1-4-24-14-5-7-18(22)25-19(15(2)21-13-6-12-20-21)16-8-10-17(23-3)11-9-16/h6,8-13,15,19H,4-5,7,14H2,1-3H3/t15-,19+/m1/s1 |
| InChIKey | QPXRTBFMMFEOFS-BEFAXECRSA-N |
| XLogP | 3.55 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate?
The IUPAC name of [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate (CID 95291315) is [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate.
What is the SMILES notation for [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate?
The canonical SMILES for [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate is CCOCCCC(=O)O[C@H](c1ccc(OC)cc1)[C@@H](C)n1cccn1.
What is the InChIKey of [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate?
The InChIKey is QPXRTBFMMFEOFS-BEFAXECRSA-N. The full InChI is InChI=1S/C19H26N2O4/c1-4-24-14-5-7-18(22)25-19(15(2)21-13-6-12-20-21)16-8-10-17(23-3)11-9-16/h6,8-13,15,19H,4-5,7,14H2,1-3H3/t15-,19+/m1/s1.
What are the key properties of [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate?
[(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate has a molecular weight of 346.43 g/mol, XLogP of 3.55, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-1-(4-methoxyphenyl)-2-pyrazol-1-ylpropyl] 4-ethoxybutanoate is sourced from PubChem (CID 95291315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).