About N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide
N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide (PubChem CID 95292001) has the molecular formula C19H19N3O3
and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide |
| PubChem CID | 95292001 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide |
| SMILES | CCN(C(=O)c1ccc(-c2ccccc2)nc1C)[C@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C19H19N3O3/c1-3-22(16-11-17(23)21-18(16)24)19(25)14-9-10-15(20-12(14)2)13-7-5-4-6-8-13/h4-10,16H,3,11H2,1-2H3,(H,21,23,24)/t16-/m0/s1 |
| InChIKey | NLLNGZXONBNOFP-INIZCTEOSA-N |
| XLogP | 1.93 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide?
The IUPAC name of N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide (CID 95292001) is N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide.
What is the SMILES notation for N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide?
The canonical SMILES for N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide is CCN(C(=O)c1ccc(-c2ccccc2)nc1C)[C@H]1CC(=O)NC1=O.
What is the InChIKey of N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide?
The InChIKey is NLLNGZXONBNOFP-INIZCTEOSA-N. The full InChI is InChI=1S/C19H19N3O3/c1-3-22(16-11-17(23)21-18(16)24)19(25)14-9-10-15(20-12(14)2)13-7-5-4-6-8-13/h4-10,16H,3,11H2,1-2H3,(H,21,23,24)/t16-/m0/s1.
What are the key properties of N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide?
N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide has a molecular weight of 337.38 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2-methyl-6-phenylpyridine-3-carboxamide is sourced from PubChem (CID 95292001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).