C12H22N2O — CID 95292502
(3R,6S)-6-methyl-1-(3-methylbut-2-enyl)piperidine-3-carboxamide (PubChem CID 95292502) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (3R,6S)-6-methyl-1-(3-methylbut-2-enyl)piperidine-3-carboxamide.
| Compound Name | (3R,6S)-6-methyl-1-(3-methylbut-2-enyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95292502 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (3R,6S)-6-methyl-1-(3-methylbut-2-enyl)piperidine-3-carboxamide |
| SMILES | CC(C)=CCN1C[C@H](C(N)=O)CC[C@@H]1C |
| InChI | InChI=1S/C12H22N2O/c1-9(2)6-7-14-8-11(12(13)15)5-4-10(14)3/h6,10-11H,4-5,7-8H2,1-3H3,(H2,13,15)/t10-,11+/m0/s1 |
| InChIKey | FKJSFZIRCGMALS-WDEREUQCSA-N |
| XLogP | 1.54 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|