C18H16F3NO2 — CID 95292524
N-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyl]-3,4,5-trifluoro-N-methylbenzamide (PubChem CID 95292524) has the molecular formula C18H16F3NO2 and a molecular weight of 335.33 g/mol. Its IUPAC name is N-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyl]-3,4,5-trifluoro-N-methylbenzamide.
| Compound Name | N-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyl]-3,4,5-trifluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 95292524 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyl]-3,4,5-trifluoro-N-methylbenzamide |
| SMILES | CN(C[C@H]1OCCc2ccccc21)C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C18H16F3NO2/c1-22(18(23)12-8-14(19)17(21)15(20)9-12)10-16-13-5-3-2-4-11(13)6-7-24-16/h2-5,8-9,16H,6-7,10H2,1H3/t16-/m1/s1 |
| InChIKey | DCFLESZDVLLMTQ-MRXNPFEDSA-N |
| XLogP | 3.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|