C14H19N3O2S2 — CID 95293035
(4S)-3-[(Z)-2-methylpent-2-enoyl]-N-(5-methyl-1,3-thiazol-2-yl)-1,3-thiazolidine-4-carboxamide (PubChem CID 95293035) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is (4S)-3-[(Z)-2-methylpent-2-enoyl]-N-(5-methyl-1,3-thiazol-2-yl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-3-[(Z)-2-methylpent-2-enoyl]-N-(5-methyl-1,3-thiazol-2-yl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 95293035 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (4S)-3-[(Z)-2-methylpent-2-enoyl]-N-(5-methyl-1,3-thiazol-2-yl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CC/C=C(/C)C(=O)N1CSC[C@@H]1C(=O)Nc1ncc(C)s1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-4-5-9(2)13(19)17-8-20-7-11(17)12(18)16-14-15-6-10(3)21-14/h5-6,11H,4,7-8H2,1-3H3,(H,15,16,18)/b9-5-/t11-/m1/s1 |
| InChIKey | XOOKABVIKZKSFD-YOOZJCNJSA-N |
| XLogP | 2.65 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|