C16H21NO4 — CID 95293966
N-[(1R)-1-(furan-2-yl)-2-(2-methylpropoxy)ethyl]-2-methylfuran-3-carboxamide (PubChem CID 95293966) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)-2-(2-methylpropoxy)ethyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[(1R)-1-(furan-2-yl)-2-(2-methylpropoxy)ethyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 95293966 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)-2-(2-methylpropoxy)ethyl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)N[C@H](COCC(C)C)c1ccco1 |
| InChI | InChI=1S/C16H21NO4/c1-11(2)9-19-10-14(15-5-4-7-21-15)17-16(18)13-6-8-20-12(13)3/h4-8,11,14H,9-10H2,1-3H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | FRYXEVNLCRHLQM-CQSZACIVSA-N |
| XLogP | 3.32 |
| TPSA | 64.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |