C18H26N2O3 — CID 95294519
cis-(1R,2S)-N-[3-[(2-hydroxyphenyl)methyl-propylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 95294519) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is cis-(1R,2S)-N-[3-[(2-hydroxyphenyl)methyl-propylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[3-[(2-hydroxyphenyl)methyl-propylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95294519 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | cis-(1R,2S)-N-[3-[(2-hydroxyphenyl)methyl-propylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | CCCN(Cc1ccccc1O)C(=O)CCNC(=O)[C@@H]1C[C@@H]1C |
| InChI | InChI=1S/C18H26N2O3/c1-3-10-20(12-14-6-4-5-7-16(14)21)17(22)8-9-19-18(23)15-11-13(15)2/h4-7,13,15,21H,3,8-12H2,1-2H3,(H,19,23)/t13-,15+/m0/s1 |
| InChIKey | CNXMJKGVFXTYAQ-DZGCQCFKSA-N |
| XLogP | 2.29 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|