About 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid
3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid (PubChem CID 95294893) has the molecular formula C15H28N2O3
and a molecular weight of 284.40 g/mol. Its IUPAC name is 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid |
| PubChem CID | 95294893 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid |
| SMILES | C[C@@H]1CN(CC2CCN(CCC(=O)O)CC2)C[C@@H](C)O1 |
| InChI | InChI=1S/C15H28N2O3/c1-12-9-17(10-13(2)20-12)11-14-3-6-16(7-4-14)8-5-15(18)19/h12-14H,3-11H2,1-2H3,(H,18,19)/t12-,13-/m1/s1 |
| InChIKey | WVSZSFJGVGEKEF-CHWSQXEVSA-N |
| XLogP | 1.28 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid?
The IUPAC name of 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid (CID 95294893) is 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid.
What is the SMILES notation for 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid?
The canonical SMILES for 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid is C[C@@H]1CN(CC2CCN(CCC(=O)O)CC2)C[C@@H](C)O1.
What is the InChIKey of 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid?
The InChIKey is WVSZSFJGVGEKEF-CHWSQXEVSA-N. The full InChI is InChI=1S/C15H28N2O3/c1-12-9-17(10-13(2)20-12)11-14-3-6-16(7-4-14)8-5-15(18)19/h12-14H,3-11H2,1-2H3,(H,18,19)/t12-,13-/m1/s1.
What are the key properties of 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid?
3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid has a molecular weight of 284.40 g/mol, XLogP of 1.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]piperidin-1-yl]propanoic acid is sourced from PubChem (CID 95294893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).