C16H14Cl2N2O2 — CID 95296582
[(2S)-2-(2-chlorophenyl)morpholin-4-yl]-(4-chloro-2-pyridinyl)methanone (PubChem CID 95296582) has the molecular formula C16H14Cl2N2O2 and a molecular weight of 337.21 g/mol. Its IUPAC name is [(2S)-2-(2-chlorophenyl)morpholin-4-yl]-(4-chloro-2-pyridinyl)methanone.
| Compound Name | [(2S)-2-(2-chlorophenyl)morpholin-4-yl]-(4-chloro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 95296582 |
| Molecular Formula | C16H14Cl2N2O2 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | [(2S)-2-(2-chlorophenyl)morpholin-4-yl]-(4-chloro-2-pyridinyl)methanone |
| SMILES | O=C(c1cc(Cl)ccn1)N1CCO[C@@H](c2ccccc2Cl)C1 |
| InChI | InChI=1S/C16H14Cl2N2O2/c17-11-5-6-19-14(9-11)16(21)20-7-8-22-15(10-20)12-3-1-2-4-13(12)18/h1-6,9,15H,7-8,10H2/t15-/m1/s1 |
| InChIKey | XZCFLAMXTSVVAM-OAHLLOKOSA-N |
| XLogP | 3.60 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |