About (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide
(2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide (PubChem CID 95297533) has the molecular formula C15H20F3N3O3
and a molecular weight of 347.34 g/mol. Its IUPAC name is (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide.
Molecular Properties
| Compound Name | (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide |
| PubChem CID | 95297533 |
| Molecular Formula | C15H20F3N3O3 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide |
| SMILES | CNC(=O)[C@@H](CC(C)C)NC(=O)Cn1cc(C(F)(F)F)ccc1=O |
| InChI | InChI=1S/C15H20F3N3O3/c1-9(2)6-11(14(24)19-3)20-12(22)8-21-7-10(15(16,17)18)4-5-13(21)23/h4-5,7,9,11H,6,8H2,1-3H3,(H,19,24)(H,20,22)/t11-/m1/s1 |
| InChIKey | PRCHZPDBCIWYPG-LLVKDONJSA-N |
| XLogP | 1.14 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide?
The IUPAC name of (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide (CID 95297533) is (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide.
What is the SMILES notation for (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide?
The canonical SMILES for (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide is CNC(=O)[C@@H](CC(C)C)NC(=O)Cn1cc(C(F)(F)F)ccc1=O.
What is the InChIKey of (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide?
The InChIKey is PRCHZPDBCIWYPG-LLVKDONJSA-N. The full InChI is InChI=1S/C15H20F3N3O3/c1-9(2)6-11(14(24)19-3)20-12(22)8-21-7-10(15(16,17)18)4-5-13(21)23/h4-5,7,9,11H,6,8H2,1-3H3,(H,19,24)(H,20,22)/t11-/m1/s1.
What are the key properties of (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide?
(2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide has a molecular weight of 347.34 g/mol, XLogP of 1.14, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N,4-dimethyl-2-[[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]amino]pentanamide is sourced from PubChem (CID 95297533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).