About (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol
(1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol (PubChem CID 95298506) has the molecular formula C16H19FN2O
and a molecular weight of 274.34 g/mol. Its IUPAC name is (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol.
Molecular Properties
| Compound Name | (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol |
| PubChem CID | 95298506 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol |
| SMILES | C[C@@H]1c2cccn2CCN1C[C@H](O)c1ccccc1F |
| InChI | InChI=1S/C16H19FN2O/c1-12-15-7-4-8-18(15)9-10-19(12)11-16(20)13-5-2-3-6-14(13)17/h2-8,12,16,20H,9-11H2,1H3/t12-,16+/m1/s1 |
| InChIKey | KVYPFDJVFYUQRY-WBMJQRKESA-N |
| XLogP | 2.74 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol?
The IUPAC name of (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol (CID 95298506) is (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol.
What is the SMILES notation for (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol?
The canonical SMILES for (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol is C[C@@H]1c2cccn2CCN1C[C@H](O)c1ccccc1F.
What is the InChIKey of (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol?
The InChIKey is KVYPFDJVFYUQRY-WBMJQRKESA-N. The full InChI is InChI=1S/C16H19FN2O/c1-12-15-7-4-8-18(15)9-10-19(12)11-16(20)13-5-2-3-6-14(13)17/h2-8,12,16,20H,9-11H2,1H3/t12-,16+/m1/s1.
What are the key properties of (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol?
(1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol has a molecular weight of 274.34 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(2-fluorophenyl)-2-[(1R)-1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanol is sourced from PubChem (CID 95298506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).