C16H18ClN3O — CID 95299069
(2S)-1-[(5-chloroquinolin-8-yl)methyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 95299069) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is (2S)-1-[(5-chloroquinolin-8-yl)methyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(5-chloroquinolin-8-yl)methyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95299069 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (2S)-1-[(5-chloroquinolin-8-yl)methyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1CCCN1Cc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C16H18ClN3O/c1-18-16(21)14-5-3-9-20(14)10-11-6-7-13(17)12-4-2-8-19-15(11)12/h2,4,6-8,14H,3,5,9-10H2,1H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | LZRIWBIPPPVTTJ-AWEZNQCLSA-N |
| XLogP | 2.60 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |