C17H24N4O4 — CID 95299587
(3R)-N-[2-(4-acetylpiperazin-1-yl)-6-methoxy-3-pyridinyl]oxolane-3-carboxamide (PubChem CID 95299587) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is (3R)-N-[2-(4-acetylpiperazin-1-yl)-6-methoxy-3-pyridinyl]oxolane-3-carboxamide.
| Compound Name | (3R)-N-[2-(4-acetylpiperazin-1-yl)-6-methoxy-3-pyridinyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 95299587 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (3R)-N-[2-(4-acetylpiperazin-1-yl)-6-methoxy-3-pyridinyl]oxolane-3-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2CCOC2)c(N2CCN(C(C)=O)CC2)n1 |
| InChI | InChI=1S/C17H24N4O4/c1-12(22)20-6-8-21(9-7-20)16-14(3-4-15(19-16)24-2)18-17(23)13-5-10-25-11-13/h3-4,13H,5-11H2,1-2H3,(H,18,23)/t13-/m1/s1 |
| InChIKey | OLNHPAKOXMWSQF-CYBMUJFWSA-N |
| XLogP | 0.73 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |