C16H19FN2O4 — CID 95300558
(3R)-1-(4-fluorophenyl)-N-[(2S)-oxan-2-yl]oxy-5-oxopyrrolidine-3-carboxamide (PubChem CID 95300558) has the molecular formula C16H19FN2O4 and a molecular weight of 322.34 g/mol. Its IUPAC name is (3R)-1-(4-fluorophenyl)-N-[(2S)-oxan-2-yl]oxy-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(4-fluorophenyl)-N-[(2S)-oxan-2-yl]oxy-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95300558 |
| Molecular Formula | C16H19FN2O4 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (3R)-1-(4-fluorophenyl)-N-[(2S)-oxan-2-yl]oxy-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NO[C@H]1CCCCO1)[C@@H]1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H19FN2O4/c17-12-4-6-13(7-5-12)19-10-11(9-14(19)20)16(21)18-23-15-3-1-2-8-22-15/h4-7,11,15H,1-3,8-10H2,(H,18,21)/t11-,15+/m1/s1 |
| InChIKey | RLEDWXKJKUQEOI-ABAIWWIYSA-N |
| XLogP | 1.75 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|