C17H26FN3O3 — CID 95300771
(2R)-N-tert-butyl-2-[(2-fluoro-4-propan-2-yloxyphenyl)carbamoylamino]propanamide (PubChem CID 95300771) has the molecular formula C17H26FN3O3 and a molecular weight of 339.41 g/mol. Its IUPAC name is (2R)-N-tert-butyl-2-[(2-fluoro-4-propan-2-yloxyphenyl)carbamoylamino]propanamide.
| Compound Name | (2R)-N-tert-butyl-2-[(2-fluoro-4-propan-2-yloxyphenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 95300771 |
| Molecular Formula | C17H26FN3O3 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (2R)-N-tert-butyl-2-[(2-fluoro-4-propan-2-yloxyphenyl)carbamoylamino]propanamide |
| SMILES | CC(C)Oc1ccc(NC(=O)N[C@H](C)C(=O)NC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C17H26FN3O3/c1-10(2)24-12-7-8-14(13(18)9-12)20-16(23)19-11(3)15(22)21-17(4,5)6/h7-11H,1-6H3,(H,21,22)(H2,19,20,23)/t11-/m1/s1 |
| InChIKey | LOFYUEWCBIVTPG-LLVKDONJSA-N |
| XLogP | 3.04 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |