C15H15FN4O3 — CID 95303849
(5S)-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 95303849) has the molecular formula C15H15FN4O3 and a molecular weight of 318.31 g/mol. Its IUPAC name is (5S)-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95303849 |
| Molecular Formula | C15H15FN4O3 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (5S)-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CCc1nc(CN2C(=O)[C@H](C)N(c3ccc(F)cc3)C2=O)no1 |
| InChI | InChI=1S/C15H15FN4O3/c1-3-13-17-12(18-23-13)8-19-14(21)9(2)20(15(19)22)11-6-4-10(16)5-7-11/h4-7,9H,3,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | QWEHRAIXGZCIKB-VIFPVBQESA-N |
| XLogP | 2.13 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|