C20H31N3O2 — CID 95304741
(2-ethoxyphenyl)-[4-[[(2R)-1-methylpiperidin-2-yl]methyl]piperazin-1-yl]methanone (PubChem CID 95304741) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (2-ethoxyphenyl)-[4-[[(2R)-1-methylpiperidin-2-yl]methyl]piperazin-1-yl]methanone.
| Compound Name | (2-ethoxyphenyl)-[4-[[(2R)-1-methylpiperidin-2-yl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 95304741 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (2-ethoxyphenyl)-[4-[[(2R)-1-methylpiperidin-2-yl]methyl]piperazin-1-yl]methanone |
| SMILES | CCOc1ccccc1C(=O)N1CCN(C[C@H]2CCCCN2C)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-3-25-19-10-5-4-9-18(19)20(24)23-14-12-22(13-15-23)16-17-8-6-7-11-21(17)2/h4-5,9-10,17H,3,6-8,11-16H2,1-2H3/t17-/m1/s1 |
| InChIKey | XLLMVMDBJNTJBT-QGZVFWFLSA-N |
| XLogP | 2.33 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |