C17H30N2O3S — CID 95306760
2-cyclopentylsulfonyl-1-[(2S)-2-[(2R)-1-ethylpyrrolidin-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 95306760) has the molecular formula C17H30N2O3S and a molecular weight of 342.51 g/mol. Its IUPAC name is 2-cyclopentylsulfonyl-1-[(2S)-2-[(2R)-1-ethylpyrrolidin-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-cyclopentylsulfonyl-1-[(2S)-2-[(2R)-1-ethylpyrrolidin-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95306760 |
| Molecular Formula | C17H30N2O3S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2-cyclopentylsulfonyl-1-[(2S)-2-[(2R)-1-ethylpyrrolidin-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CCN1CCC[C@@H]1[C@@H]1CCCN1C(=O)CS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C17H30N2O3S/c1-2-18-11-5-9-15(18)16-10-6-12-19(16)17(20)13-23(21,22)14-7-3-4-8-14/h14-16H,2-13H2,1H3/t15-,16+/m1/s1 |
| InChIKey | OUDGSFRTHPRYMC-CVEARBPZSA-N |
| XLogP | 1.82 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |