C15H20N4O2S — CID 95306807
3-[(1R)-1-[methyl-[(5-methylpyrazin-2-yl)methyl]amino]ethyl]benzenesulfonamide (PubChem CID 95306807) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 3-[(1R)-1-[methyl-[(5-methylpyrazin-2-yl)methyl]amino]ethyl]benzenesulfonamide.
| Compound Name | 3-[(1R)-1-[methyl-[(5-methylpyrazin-2-yl)methyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 95306807 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-[(1R)-1-[methyl-[(5-methylpyrazin-2-yl)methyl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1cnc(CN(C)[C@H](C)c2cccc(S(N)(=O)=O)c2)cn1 |
| InChI | InChI=1S/C15H20N4O2S/c1-11-8-18-14(9-17-11)10-19(3)12(2)13-5-4-6-15(7-13)22(16,20)21/h4-9,12H,10H2,1-3H3,(H2,16,20,21)/t12-/m1/s1 |
| InChIKey | IERWCCNKHFUIQC-GFCCVEGCSA-N |
| XLogP | 1.63 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |