C12H19F3N4O — CID 95307653
(6S)-2-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95307653) has the molecular formula C12H19F3N4O and a molecular weight of 292.31 g/mol. Its IUPAC name is (6S)-2-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-2-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95307653 |
| Molecular Formula | C12H19F3N4O |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (6S)-2-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CCc1nc2n(n1)C[C@@H](NCCOCC(F)(F)F)CC2 |
| InChI | InChI=1S/C12H19F3N4O/c1-2-10-17-11-4-3-9(7-19(11)18-10)16-5-6-20-8-12(13,14)15/h9,16H,2-8H2,1H3/t9-/m0/s1 |
| InChIKey | MMRBBDKJIMPXSL-VIFPVBQESA-N |
| XLogP | 1.32 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|