C15H23F3N4O2 — CID 95309192
3-cyclopropyl-5-[(1R)-1-[4-[2-(2,2,2-trifluoroethoxy)ethyl]piperazin-1-yl]ethyl]-1,2,4-oxadiazole (PubChem CID 95309192) has the molecular formula C15H23F3N4O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 3-cyclopropyl-5-[(1R)-1-[4-[2-(2,2,2-trifluoroethoxy)ethyl]piperazin-1-yl]ethyl]-1,2,4-oxadiazole.
| Compound Name | 3-cyclopropyl-5-[(1R)-1-[4-[2-(2,2,2-trifluoroethoxy)ethyl]piperazin-1-yl]ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 95309192 |
| Molecular Formula | C15H23F3N4O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 3-cyclopropyl-5-[(1R)-1-[4-[2-(2,2,2-trifluoroethoxy)ethyl]piperazin-1-yl]ethyl]-1,2,4-oxadiazole |
| SMILES | C[C@H](c1nc(C2CC2)no1)N1CCN(CCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H23F3N4O2/c1-11(14-19-13(20-24-14)12-2-3-12)22-6-4-21(5-7-22)8-9-23-10-15(16,17)18/h11-12H,2-10H2,1H3/t11-/m1/s1 |
| InChIKey | DWGUZEWLRNHOPP-LLVKDONJSA-N |
| XLogP | 2.20 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|