C14H16FN3O2S — CID 95310230
4-[(3S)-3-(3-fluorophenyl)pyrrolidin-1-yl]sulfonyl-1-methylpyrazole (PubChem CID 95310230) has the molecular formula C14H16FN3O2S and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-[(3S)-3-(3-fluorophenyl)pyrrolidin-1-yl]sulfonyl-1-methylpyrazole.
| Compound Name | 4-[(3S)-3-(3-fluorophenyl)pyrrolidin-1-yl]sulfonyl-1-methylpyrazole |
|---|---|
| PubChem CID | 95310230 |
| Molecular Formula | C14H16FN3O2S |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-[(3S)-3-(3-fluorophenyl)pyrrolidin-1-yl]sulfonyl-1-methylpyrazole |
| SMILES | Cn1cc(S(=O)(=O)N2CC[C@@H](c3cccc(F)c3)C2)cn1 |
| InChI | InChI=1S/C14H16FN3O2S/c1-17-10-14(8-16-17)21(19,20)18-6-5-12(9-18)11-3-2-4-13(15)7-11/h2-4,7-8,10,12H,5-6,9H2,1H3/t12-/m1/s1 |
| InChIKey | MBMITZKXOGEQHO-GFCCVEGCSA-N |
| XLogP | 1.74 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |