C18H22N2O3S — CID 95310566
N-methyl-2-[2-[[2-[(S)-phenylsulfinyl]ethylamino]methyl]phenoxy]acetamide (PubChem CID 95310566) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N-methyl-2-[2-[[2-[(S)-phenylsulfinyl]ethylamino]methyl]phenoxy]acetamide.
| Compound Name | N-methyl-2-[2-[[2-[(S)-phenylsulfinyl]ethylamino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 95310566 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-methyl-2-[2-[[2-[(S)-phenylsulfinyl]ethylamino]methyl]phenoxy]acetamide |
| SMILES | CNC(=O)COc1ccccc1CNCC[S@](=O)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O3S/c1-19-18(21)14-23-17-10-6-5-7-15(17)13-20-11-12-24(22)16-8-3-2-4-9-16/h2-10,20H,11-14H2,1H3,(H,19,21)/t24-/m0/s1 |
| InChIKey | XXWURVRKTPRLCN-DEOSSOPVSA-N |
| XLogP | 1.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|