C17H17N3O3 — CID 95311717
2H-benzotriazol-5-ylmethyl (2S)-2-ethoxy-2-phenylacetate (PubChem CID 95311717) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2H-benzotriazol-5-ylmethyl (2S)-2-ethoxy-2-phenylacetate.
| Compound Name | 2H-benzotriazol-5-ylmethyl (2S)-2-ethoxy-2-phenylacetate |
|---|---|
| PubChem CID | 95311717 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2H-benzotriazol-5-ylmethyl (2S)-2-ethoxy-2-phenylacetate |
| SMILES | CCO[C@H](C(=O)OCc1ccc2n[nH]nc2c1)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O3/c1-2-22-16(13-6-4-3-5-7-13)17(21)23-11-12-8-9-14-15(10-12)19-20-18-14/h3-10,16H,2,11H2,1H3,(H,18,19,20)/t16-/m0/s1 |
| InChIKey | RYTZGOCEVAGFEN-INIZCTEOSA-N |
| XLogP | 2.78 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |