About N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide
N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide (PubChem CID 953142) has the molecular formula C18H19N5O
and a molecular weight of 321.38 g/mol. Its IUPAC name is N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide.
Molecular Properties
| Compound Name | N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide |
| PubChem CID | 953142 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide |
| SMILES | CCn1nnc(NC(=O)C(C)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C18H19N5O/c1-3-23-21-17(20-22-23)19-16(24)18(2,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,3H2,1-2H3,(H,19,21,24) |
| InChIKey | PMPZNGGXCKZDGB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide?
The IUPAC name of N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide (CID 953142) is N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide.
What is the SMILES notation for N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide?
The canonical SMILES for N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide is CCn1nnc(NC(=O)C(C)(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide?
The InChIKey is PMPZNGGXCKZDGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N5O/c1-3-23-21-17(20-22-23)19-16(24)18(2,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,3H2,1-2H3,(H,19,21,24).
What are the key properties of N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide?
N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide has a molecular weight of 321.38 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethyltetrazol-5-yl)-2,2-diphenylpropanamide is sourced from PubChem (CID 953142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).