C16H19N5O2S — CID 95316362
1,3-dimethyl-4-[methyl-[(7S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]amino]-2,6-dioxopyrimidine-5-carbonitrile (PubChem CID 95316362) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is 1,3-dimethyl-4-[methyl-[(7S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]amino]-2,6-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1,3-dimethyl-4-[methyl-[(7S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]amino]-2,6-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 95316362 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1,3-dimethyl-4-[methyl-[(7S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]amino]-2,6-dioxopyrimidine-5-carbonitrile |
| SMILES | Cc1nc2c(s1)[C@@H](N(C)c1c(C#N)c(=O)n(C)c(=O)n1C)CCC2 |
| InChI | InChI=1S/C16H19N5O2S/c1-9-18-11-6-5-7-12(13(11)24-9)19(2)14-10(8-17)15(22)21(4)16(23)20(14)3/h12H,5-7H2,1-4H3/t12-/m0/s1 |
| InChIKey | ZCHSSLSCPRULSD-LBPRGKRZSA-N |
| XLogP | 1.23 |
| TPSA | 83.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |