About cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide
cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide (PubChem CID 95317380) has the molecular formula C14H18N2OS
and a molecular weight of 262.38 g/mol. Its IUPAC name is cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide |
| PubChem CID | 95317380 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide |
| SMILES | CC[C@@](C)(C#N)NC(=O)[C@@H]1C[C@@H]1c1ccc(C)s1 |
| InChI | InChI=1S/C14H18N2OS/c1-4-14(3,8-15)16-13(17)11-7-10(11)12-6-5-9(2)18-12/h5-6,10-11H,4,7H2,1-3H3,(H,16,17)/t10-,11+,14-/m0/s1 |
| InChIKey | OUNXDNQANPREGP-WDMOLILDSA-N |
| XLogP | 2.97 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide?
The IUPAC name of cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide (CID 95317380) is cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide.
What is the SMILES notation for cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide?
The canonical SMILES for cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide is CC[C@@](C)(C#N)NC(=O)[C@@H]1C[C@@H]1c1ccc(C)s1.
What is the InChIKey of cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide?
The InChIKey is OUNXDNQANPREGP-WDMOLILDSA-N. The full InChI is InChI=1S/C14H18N2OS/c1-4-14(3,8-15)16-13(17)11-7-10(11)12-6-5-9(2)18-12/h5-6,10-11H,4,7H2,1-3H3,(H,16,17)/t10-,11+,14-/m0/s1.
What are the key properties of cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide?
cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide has a molecular weight of 262.38 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-N-[(2S)-2-cyanobutan-2-yl]-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide is sourced from PubChem (CID 95317380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).