C15H21N5O — CID 95317595
4-methoxy-2-[(2R)-2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]pyrimidine (PubChem CID 95317595) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 4-methoxy-2-[(2R)-2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]pyrimidine.
| Compound Name | 4-methoxy-2-[(2R)-2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 95317595 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 4-methoxy-2-[(2R)-2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]pyrimidine |
| SMILES | COc1ccnc(N2CCCC[C@@H]2Cn2cc(C)cn2)n1 |
| InChI | InChI=1S/C15H21N5O/c1-12-9-17-19(10-12)11-13-5-3-4-8-20(13)15-16-7-6-14(18-15)21-2/h6-7,9-10,13H,3-5,8,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | QDKVZUSXZITFGP-CYBMUJFWSA-N |
| XLogP | 2.05 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |