C16H21F3N2O3 — CID 95318609
(2R)-N-[[4-(dimethylamino)phenyl]methyl]-N-(2,2,2-trifluoroethyl)-1,4-dioxane-2-carboxamide (PubChem CID 95318609) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is (2R)-N-[[4-(dimethylamino)phenyl]methyl]-N-(2,2,2-trifluoroethyl)-1,4-dioxane-2-carboxamide.
| Compound Name | (2R)-N-[[4-(dimethylamino)phenyl]methyl]-N-(2,2,2-trifluoroethyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 95318609 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (2R)-N-[[4-(dimethylamino)phenyl]methyl]-N-(2,2,2-trifluoroethyl)-1,4-dioxane-2-carboxamide |
| SMILES | CN(C)c1ccc(CN(CC(F)(F)F)C(=O)[C@H]2COCCO2)cc1 |
| InChI | InChI=1S/C16H21F3N2O3/c1-20(2)13-5-3-12(4-6-13)9-21(11-16(17,18)19)15(22)14-10-23-7-8-24-14/h3-6,14H,7-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | JKWXVPRPCKTMRK-CQSZACIVSA-N |
| XLogP | 2.06 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|