C19H22N2O3 — CID 95318865
3-methyl-5-propan-2-yl-N-[(1R)-1-(3-prop-2-ynoxyphenyl)ethyl]-1,2-oxazole-4-carboxamide (PubChem CID 95318865) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-methyl-5-propan-2-yl-N-[(1R)-1-(3-prop-2-ynoxyphenyl)ethyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3-methyl-5-propan-2-yl-N-[(1R)-1-(3-prop-2-ynoxyphenyl)ethyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 95318865 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-methyl-5-propan-2-yl-N-[(1R)-1-(3-prop-2-ynoxyphenyl)ethyl]-1,2-oxazole-4-carboxamide |
| SMILES | C#CCOc1cccc([C@@H](C)NC(=O)c2c(C)noc2C(C)C)c1 |
| InChI | InChI=1S/C19H22N2O3/c1-6-10-23-16-9-7-8-15(11-16)13(4)20-19(22)17-14(5)21-24-18(17)12(2)3/h1,7-9,11-13H,10H2,2-5H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | RUMGADZXYZOBLQ-CYBMUJFWSA-N |
| XLogP | 3.61 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|