C16H24N4O2S — CID 95319042
N-[2-[[(2S,3S)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 95319042) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[2-[[(2S,3S)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[[(2S,3S)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 95319042 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[2-[[(2S,3S)-3-(4-methylpyrazol-1-yl)butan-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1cnn([C@@H](C)[C@H](C)NCCNS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H24N4O2S/c1-13-11-18-20(12-13)15(3)14(2)17-9-10-19-23(21,22)16-7-5-4-6-8-16/h4-8,11-12,14-15,17,19H,9-10H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | RWPWIKQIMBJSTR-GJZGRUSLSA-N |
| XLogP | 1.71 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|