C19H22N4O2 — CID 95321311
6-[(3R,8aR)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-2-phenylpyridazin-3-one (PubChem CID 95321311) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 6-[(3R,8aR)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-2-phenylpyridazin-3-one.
| Compound Name | 6-[(3R,8aR)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 95321311 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 6-[(3R,8aR)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-2-phenylpyridazin-3-one |
| SMILES | C[C@@H]1CN2CCC[C@@H]2CN1C(=O)c1ccc(=O)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H22N4O2/c1-14-12-21-11-5-8-16(21)13-22(14)19(25)17-9-10-18(24)23(20-17)15-6-3-2-4-7-15/h2-4,6-7,9-10,14,16H,5,8,11-13H2,1H3/t14-,16-/m1/s1 |
| InChIKey | JHQZKOCBEGBYIV-GDBMZVCRSA-N |
| XLogP | 1.54 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |