C15H21ClFNO3S — CID 95322200
2-(2-chloro-6-fluorophenyl)-N-ethyl-N-[(2R)-1-ethylsulfonylpropan-2-yl]acetamide (PubChem CID 95322200) has the molecular formula C15H21ClFNO3S and a molecular weight of 349.86 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-ethyl-N-[(2R)-1-ethylsulfonylpropan-2-yl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-ethyl-N-[(2R)-1-ethylsulfonylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 95322200 |
| Molecular Formula | C15H21ClFNO3S |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-ethyl-N-[(2R)-1-ethylsulfonylpropan-2-yl]acetamide |
| SMILES | CCN(C(=O)Cc1c(F)cccc1Cl)[C@H](C)CS(=O)(=O)CC |
| InChI | InChI=1S/C15H21ClFNO3S/c1-4-18(11(3)10-22(20,21)5-2)15(19)9-12-13(16)7-6-8-14(12)17/h6-8,11H,4-5,9-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | QKSWPXDWWYADDT-LLVKDONJSA-N |
| XLogP | 2.69 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |