C19H34N4O — CID 95324163
2-[(3S)-3-(azepan-1-yl)piperidin-1-yl]-N-[(2R)-2-cyano-3-methylbutan-2-yl]acetamide (PubChem CID 95324163) has the molecular formula C19H34N4O and a molecular weight of 334.51 g/mol. Its IUPAC name is 2-[(3S)-3-(azepan-1-yl)piperidin-1-yl]-N-[(2R)-2-cyano-3-methylbutan-2-yl]acetamide.
| Compound Name | 2-[(3S)-3-(azepan-1-yl)piperidin-1-yl]-N-[(2R)-2-cyano-3-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 95324163 |
| Molecular Formula | C19H34N4O |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 2-[(3S)-3-(azepan-1-yl)piperidin-1-yl]-N-[(2R)-2-cyano-3-methylbutan-2-yl]acetamide |
| SMILES | CC(C)[C@](C)(C#N)NC(=O)CN1CCC[C@H](N2CCCCCC2)C1 |
| InChI | InChI=1S/C19H34N4O/c1-16(2)19(3,15-20)21-18(24)14-22-10-8-9-17(13-22)23-11-6-4-5-7-12-23/h16-17H,4-14H2,1-3H3,(H,21,24)/t17-,19-/m0/s1 |
| InChIKey | LGMILPKKUHNLOC-HKUYNNGSSA-N |
| XLogP | 2.38 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |