C17H21N3O — CID 95324191
1-[(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-indazol-1-ylethanone (PubChem CID 95324191) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-[(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-indazol-1-ylethanone.
| Compound Name | 1-[(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-indazol-1-ylethanone |
|---|---|
| PubChem CID | 95324191 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-[(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-indazol-1-ylethanone |
| SMILES | O=C(Cn1ncc2ccccc21)N1CC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C17H21N3O/c21-17(19-10-9-13-5-1-3-7-15(13)19)12-20-16-8-4-2-6-14(16)11-18-20/h2,4,6,8,11,13,15H,1,3,5,7,9-10,12H2/t13-,15-/m1/s1 |
| InChIKey | DWAOWLCSWLVFTK-UKRRQHHQSA-N |
| XLogP | 2.83 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |