C18H20N6O — CID 95324237
(5-methyl-2-phenyltriazol-4-yl)-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 95324237) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is (5-methyl-2-phenyltriazol-4-yl)-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-methyl-2-phenyltriazol-4-yl)-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95324237 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (5-methyl-2-phenyltriazol-4-yl)-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)N1CCC[C@H]1Cn1cccn1 |
| InChI | InChI=1S/C18H20N6O/c1-14-17(21-24(20-14)15-7-3-2-4-8-15)18(25)23-12-5-9-16(23)13-22-11-6-10-19-22/h2-4,6-8,10-11,16H,5,9,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | FZCJTUDFOCIJTH-INIZCTEOSA-N |
| XLogP | 2.08 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |