C18H28N4O — CID 95325754
[(1R)-cyclohex-3-en-1-yl]-[4-[(1-ethylimidazol-2-yl)methyl]-1,4-diazepan-1-yl]methanone (PubChem CID 95325754) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is [(1R)-cyclohex-3-en-1-yl]-[4-[(1-ethylimidazol-2-yl)methyl]-1,4-diazepan-1-yl]methanone.
| Compound Name | [(1R)-cyclohex-3-en-1-yl]-[4-[(1-ethylimidazol-2-yl)methyl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 95325754 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | [(1R)-cyclohex-3-en-1-yl]-[4-[(1-ethylimidazol-2-yl)methyl]-1,4-diazepan-1-yl]methanone |
| SMILES | CCn1ccnc1CN1CCCN(C(=O)[C@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C18H28N4O/c1-2-21-12-9-19-17(21)15-20-10-6-11-22(14-13-20)18(23)16-7-4-3-5-8-16/h3-4,9,12,16H,2,5-8,10-11,13-15H2,1H3/t16-/m0/s1 |
| InChIKey | VZVSFOFHZADTCT-INIZCTEOSA-N |
| XLogP | 2.29 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|