About [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate
[(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate (PubChem CID 95325839) has the molecular formula C16H15ClN2O3
and a molecular weight of 318.76 g/mol. Its IUPAC name is [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate.
Molecular Properties
| Compound Name | [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate |
| PubChem CID | 95325839 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate |
| SMILES | C[C@H](OC(=O)c1cccc(N)c1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H15ClN2O3/c1-10(15(20)19-14-8-3-2-7-13(14)17)22-16(21)11-5-4-6-12(18)9-11/h2-10H,18H2,1H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | UGEBDIQLJTYPBZ-JTQLQIEISA-N |
| XLogP | 3.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate?
The IUPAC name of [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate (CID 95325839) is [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate.
What is the SMILES notation for [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate?
The canonical SMILES for [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate is C[C@H](OC(=O)c1cccc(N)c1)C(=O)Nc1ccccc1Cl.
What is the InChIKey of [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate?
The InChIKey is UGEBDIQLJTYPBZ-JTQLQIEISA-N. The full InChI is InChI=1S/C16H15ClN2O3/c1-10(15(20)19-14-8-3-2-7-13(14)17)22-16(21)11-5-4-6-12(18)9-11/h2-10H,18H2,1H3,(H,19,20)/t10-/m0/s1.
What are the key properties of [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate?
[(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate has a molecular weight of 318.76 g/mol, XLogP of 3.11, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-aminobenzoate is sourced from PubChem (CID 95325839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).