C17H26ClN3O2 — CID 95326255
N-[(3-chlorophenyl)methyl]-2-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]-N-methylacetamide (PubChem CID 95326255) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]-N-methylacetamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 95326255 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]-N-methylacetamide |
| SMILES | C[C@@H](O)CN1CCN(CC(=O)N(C)Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H26ClN3O2/c1-14(22)11-20-6-8-21(9-7-20)13-17(23)19(2)12-15-4-3-5-16(18)10-15/h3-5,10,14,22H,6-9,11-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | HRQJUSDXAQRGLG-CQSZACIVSA-N |
| XLogP | 1.30 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |