C13H19N3O2S2 — CID 95326627
(4R)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-[(Z)-2-methylpent-2-enoyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 95326627) has the molecular formula C13H19N3O2S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is (4R)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-[(Z)-2-methylpent-2-enoyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-[(Z)-2-methylpent-2-enoyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 95326627 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (4R)-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-[(Z)-2-methylpent-2-enoyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CC/C=C(/C)C(=O)N1CSC[C@H]1C(=O)NC1=NCCS1 |
| InChI | InChI=1S/C13H19N3O2S2/c1-3-4-9(2)12(18)16-8-19-7-10(16)11(17)15-13-14-5-6-20-13/h4,10H,3,5-8H2,1-2H3,(H,14,15,17)/b9-4-/t10-/m0/s1 |
| InChIKey | MHRADWDRQXJCDI-FWAPLPHYSA-N |
| XLogP | 1.46 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|