C15H16FNO3S2 — CID 95326957
(3S)-3-(2-fluorophenyl)-N-(5-methylthiophen-2-yl)sulfonylbutanamide (PubChem CID 95326957) has the molecular formula C15H16FNO3S2 and a molecular weight of 341.43 g/mol. Its IUPAC name is (3S)-3-(2-fluorophenyl)-N-(5-methylthiophen-2-yl)sulfonylbutanamide.
| Compound Name | (3S)-3-(2-fluorophenyl)-N-(5-methylthiophen-2-yl)sulfonylbutanamide |
|---|---|
| PubChem CID | 95326957 |
| Molecular Formula | C15H16FNO3S2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | (3S)-3-(2-fluorophenyl)-N-(5-methylthiophen-2-yl)sulfonylbutanamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)C[C@H](C)c2ccccc2F)s1 |
| InChI | InChI=1S/C15H16FNO3S2/c1-10(12-5-3-4-6-13(12)16)9-14(18)17-22(19,20)15-8-7-11(2)21-15/h3-8,10H,9H2,1-2H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | FEIRLMHLALPSAS-JTQLQIEISA-N |
| XLogP | 3.19 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |