About 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea
3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea (PubChem CID 95327051) has the molecular formula C19H20FN3O
and a molecular weight of 325.39 g/mol. Its IUPAC name is 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea.
Molecular Properties
| Compound Name | 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea |
| PubChem CID | 95327051 |
| Molecular Formula | C19H20FN3O |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)N[C@@H](c1ccc(F)cc1)c1ccccn1 |
| InChI | InChI=1S/C19H20FN3O/c1-3-13-23(14-4-2)19(24)22-18(17-7-5-6-12-21-17)15-8-10-16(20)11-9-15/h3-12,18H,1-2,13-14H2,(H,22,24)/t18-/m0/s1 |
| InChIKey | ZLLKPDIPYNIPFR-SFHVURJKSA-N |
| XLogP | 3.69 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea?
The IUPAC name of 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea (CID 95327051) is 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea.
What is the SMILES notation for 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea?
The canonical SMILES for 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea is C=CCN(CC=C)C(=O)N[C@@H](c1ccc(F)cc1)c1ccccn1.
What is the InChIKey of 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea?
The InChIKey is ZLLKPDIPYNIPFR-SFHVURJKSA-N. The full InChI is InChI=1S/C19H20FN3O/c1-3-13-23(14-4-2)19(24)22-18(17-7-5-6-12-21-17)15-8-10-16(20)11-9-15/h3-12,18H,1-2,13-14H2,(H,22,24)/t18-/m0/s1.
What are the key properties of 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea?
3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea has a molecular weight of 325.39 g/mol, XLogP of 3.69, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-1,1-bis(prop-2-enyl)urea is sourced from PubChem (CID 95327051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).