C16H27N5O2 — CID 95328398
1-[(2S)-4-ethylmorpholin-2-yl]-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]methanamine (PubChem CID 95328398) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 1-[(2S)-4-ethylmorpholin-2-yl]-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]methanamine.
| Compound Name | 1-[(2S)-4-ethylmorpholin-2-yl]-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]methanamine |
|---|---|
| PubChem CID | 95328398 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 1-[(2S)-4-ethylmorpholin-2-yl]-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]methanamine |
| SMILES | CCN1CCO[C@@H](CNCc2cnc(N3CCOCC3)nc2)C1 |
| InChI | InChI=1S/C16H27N5O2/c1-2-20-3-8-23-15(13-20)12-17-9-14-10-18-16(19-11-14)21-4-6-22-7-5-21/h10-11,15,17H,2-9,12-13H2,1H3/t15-/m0/s1 |
| InChIKey | UFONSVMKDIXIGX-HNNXBMFYSA-N |
| XLogP | 0.12 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |