C16H21N3O2 — CID 95329190
1-[(2R)-2-hydroxy-3,3-dimethylbutyl]-3-isoquinolin-5-ylurea (PubChem CID 95329190) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3,3-dimethylbutyl]-3-isoquinolin-5-ylurea.
| Compound Name | 1-[(2R)-2-hydroxy-3,3-dimethylbutyl]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 95329190 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3,3-dimethylbutyl]-3-isoquinolin-5-ylurea |
| SMILES | CC(C)(C)[C@@H](O)CNC(=O)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C16H21N3O2/c1-16(2,3)14(20)10-18-15(21)19-13-6-4-5-11-9-17-8-7-12(11)13/h4-9,14,20H,10H2,1-3H3,(H2,18,19,21)/t14-/m0/s1 |
| InChIKey | QALJDTALOOEBHH-AWEZNQCLSA-N |
| XLogP | 2.76 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |